S-tryptophan anion
- CAS:
- Other names: S-Trp-
- SMILES: N[C@@H](CC1=CNC2=C1C=CC=C2)C([O-])=O
Properties
| MW | HBA | HBD | LogP | TPSA | Rot. | Comp. | Fsp3C | Brutto formula |
|---|---|---|---|---|---|---|---|---|
| 203.22 | 2 | 2 | 0.49 | 81.94 | 3 | 76 | 0.18 | C11H11N2O2- |
Availability
| Suppliers | Supplier IDs | Storage | Storage ID | Quantity | Class | Added |
|---|---|---|---|---|---|---|
| JN_397 | None | Jan. 1, 2023 |
Bar codes
| Plate barcode | Sample barcode |
|---|---|
PAINS
| Identified PAINS |
|---|
| Not checked |
Supramolecules
| Name | log K | SD | pH | T(°C) | Method | Ref |
|---|---|---|---|---|---|---|
| [6A-(3-Aminopropylamino)-6A-deoxy-BCD complex with Co2+](1).[S-tryptophan anion] | 4.32 | 0.05 | 25.0 | pH titration | Stephen F. Lincoln 1994 | |
| [6A-(3-Aminopropylamino)-6A-deoxy-BCD complex with Cu2+](1).[S-tryptophan anion] | 8.09 | 0.05 | 25.0 | pH titration | Stephen F. Lincoln 1994 | |
| [6A-(3-Aminopropylamino)-6A-deoxy-BCD complex with Ni2+](1).[S-tryptophan anion] | 5.10 | 0.20 | 25.0 | pH titration | Stephen F. Lincoln 1994 | |